C22H22ClN3O6 — CID 2510816
N'-(5-chloro-2-methoxybenzoyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzohydrazide (PubChem CID 2510816) has the molecular formula C22H22ClN3O6 and a molecular weight of 459.89 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxybenzoyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzohydrazide.
| Compound Name | N'-(5-chloro-2-methoxybenzoyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 2510816 |
| Molecular Formula | C22H22ClN3O6 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N'-(5-chloro-2-methoxybenzoyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc(Cl)ccc2OC)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C22H22ClN3O6/c1-12-17(13(2)32-26-12)11-31-19-7-5-14(9-20(19)30-4)21(27)24-25-22(28)16-10-15(23)6-8-18(16)29-3/h5-10H,11H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | BCCCDGOSOFHKAE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|