C23H25N3O7 — CID 25162867
N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 25162867) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 25162867 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N'-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccccc2OCc2c(C)noc2C)cc(OC)c1OC |
| InChI | InChI=1S/C23H25N3O7/c1-13-17(14(2)33-26-13)12-32-18-9-7-6-8-16(18)23(28)25-24-22(27)15-10-19(29-3)21(31-5)20(11-15)30-4/h6-11H,12H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | HJVKAOMBPGHJRT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|