C19H22N2O6 — CID 4926525
N'-(2-ethoxybenzoyl)-3,4,5-trimethoxybenzohydrazide (PubChem CID 4926525) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is N'-(2-ethoxybenzoyl)-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-(2-ethoxybenzoyl)-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 4926525 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N'-(2-ethoxybenzoyl)-3,4,5-trimethoxybenzohydrazide |
| SMILES | CCOc1ccccc1C(=O)NNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O6/c1-5-27-14-9-7-6-8-13(14)19(23)21-20-18(22)12-10-15(24-2)17(26-4)16(11-12)25-3/h6-11H,5H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | JDUNNCNERBCONR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|