C23H21N3O4 — CID 4926581
N-[4-[[(2-ethoxybenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 4926581) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[4-[[(2-ethoxybenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[(2-ethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4926581 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[4-[[(2-ethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NNC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-2-30-20-11-7-6-10-19(20)23(29)26-25-22(28)17-12-14-18(15-13-17)24-21(27)16-8-4-3-5-9-16/h3-15H,2H2,1H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | UMAYSKYNLWWOGA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|