C27H29N3O6 — CID 24658864
N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 24658864) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 24658864 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H29N3O6/c1-4-34-22-16-20(17-23(35-5-2)24(22)36-6-3)27(33)30-29-26(32)19-12-14-21(15-13-19)28-25(31)18-10-8-7-9-11-18/h7-17H,4-6H2,1-3H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | HWQYQIHOBZKYOW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|