C23H29N3O6S — CID 4282822
ethyl 4-[[(3,4,5-triethoxybenzoyl)amino]carbamothioylamino]benzoate (PubChem CID 4282822) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is ethyl 4-[[(3,4,5-triethoxybenzoyl)amino]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[(3,4,5-triethoxybenzoyl)amino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4282822 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | ethyl 4-[[(3,4,5-triethoxybenzoyl)amino]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NNC(=O)c2cc(OCC)c(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C23H29N3O6S/c1-5-29-18-13-16(14-19(30-6-2)20(18)31-7-3)21(27)25-26-23(33)24-17-11-9-15(10-12-17)22(28)32-8-4/h9-14H,5-8H2,1-4H3,(H,25,27)(H2,24,26,33) |
| InChIKey | AMPUTYYKPSEGPA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|