C19H23N3O3S — CID 8683261
1-[(4-ethoxy-3-methoxybenzoyl)amino]-3-(4-ethylphenyl)thiourea (PubChem CID 8683261) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxybenzoyl)amino]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[(4-ethoxy-3-methoxybenzoyl)amino]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 8683261 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxybenzoyl)amino]-3-(4-ethylphenyl)thiourea |
| SMILES | CCOc1ccc(C(=O)NNC(=S)Nc2ccc(CC)cc2)cc1OC |
| InChI | InChI=1S/C19H23N3O3S/c1-4-13-6-9-15(10-7-13)20-19(26)22-21-18(23)14-8-11-16(25-5-2)17(12-14)24-3/h6-12H,4-5H2,1-3H3,(H,21,23)(H2,20,22,26) |
| InChIKey | MFNNMGSCDATCLG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|