C22H28N2O6 — CID 24553442
N'-(4-butoxy-3-methoxybenzoyl)-3-ethoxy-4-methoxybenzohydrazide (PubChem CID 24553442) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-3-ethoxy-4-methoxybenzohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-3-ethoxy-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 24553442 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-3-ethoxy-4-methoxybenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2ccc(OC)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C22H28N2O6/c1-5-7-12-30-18-11-9-15(13-19(18)28-4)21(25)23-24-22(26)16-8-10-17(27-3)20(14-16)29-6-2/h8-11,13-14H,5-7,12H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | LMEZEMDCXGDVEK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|