C19H24N2O5 — CID 26784336
N'-(4-butoxy-3-methoxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 26784336) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26784336 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2cc(C)oc2C)cc1OC |
| InChI | InChI=1S/C19H24N2O5/c1-5-6-9-25-16-8-7-14(11-17(16)24-4)18(22)20-21-19(23)15-10-12(2)26-13(15)3/h7-8,10-11H,5-6,9H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | YTRSCKSLIGCWQB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|