C20H25N3O4 — CID 25443040
N'-[4-(dimethylamino)benzoyl]-3-methoxy-4-propoxybenzohydrazide (PubChem CID 25443040) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N'-[4-(dimethylamino)benzoyl]-3-methoxy-4-propoxybenzohydrazide.
| Compound Name | N'-[4-(dimethylamino)benzoyl]-3-methoxy-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 25443040 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N'-[4-(dimethylamino)benzoyl]-3-methoxy-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C20H25N3O4/c1-5-12-27-17-11-8-15(13-18(17)26-4)20(25)22-21-19(24)14-6-9-16(10-7-14)23(2)3/h6-11,13H,5,12H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | PAFLGHLVJKFTGH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|