C16H16Cl2N2O4S — CID 25443168
2,5-dichloro-N'-(3-methoxy-4-propoxybenzoyl)thiophene-3-carbohydrazide (PubChem CID 25443168) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is 2,5-dichloro-N'-(3-methoxy-4-propoxybenzoyl)thiophene-3-carbohydrazide.
| Compound Name | 2,5-dichloro-N'-(3-methoxy-4-propoxybenzoyl)thiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 25443168 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2,5-dichloro-N'-(3-methoxy-4-propoxybenzoyl)thiophene-3-carbohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2cc(Cl)sc2Cl)cc1OC |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-3-6-24-11-5-4-9(7-12(11)23-2)15(21)19-20-16(22)10-8-13(17)25-14(10)18/h4-5,7-8H,3,6H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | KIOHWSQNTDPFRI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|