C23H23N3O2S — CID 8616375
1-(4-ethylphenyl)-3-[[4-(phenoxymethyl)benzoyl]amino]thiourea (PubChem CID 8616375) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[[4-(phenoxymethyl)benzoyl]amino]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[[4-(phenoxymethyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 8616375 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[[4-(phenoxymethyl)benzoyl]amino]thiourea |
| SMILES | CCc1ccc(NC(=S)NNC(=O)c2ccc(COc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-2-17-10-14-20(15-11-17)24-23(29)26-25-22(27)19-12-8-18(9-13-19)16-28-21-6-4-3-5-7-21/h3-15H,2,16H2,1H3,(H,25,27)(H2,24,26,29) |
| InChIKey | PBJVETRCFDJGMQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|