C27H22N2O2S — CID 4947562
4-phenyl-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide (PubChem CID 4947562) has the molecular formula C27H22N2O2S and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-phenyl-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 4-phenyl-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4947562 |
| Molecular Formula | C27H22N2O2S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 4-phenyl-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCc2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N2O2S/c30-26(23-13-11-22(12-14-23)21-9-5-2-6-10-21)29-27(32)28-24-15-17-25(18-16-24)31-19-20-7-3-1-4-8-20/h1-18H,19H2,(H2,28,29,30,32) |
| InChIKey | ZDAOKNPLWIILPE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|