C25H20N2O2S — CID 22775968
N-(naphthalen-1-ylcarbamothioyl)-4-phenylmethoxybenzamide (PubChem CID 22775968) has the molecular formula C25H20N2O2S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-(naphthalen-1-ylcarbamothioyl)-4-phenylmethoxybenzamide.
| Compound Name | N-(naphthalen-1-ylcarbamothioyl)-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 22775968 |
| Molecular Formula | C25H20N2O2S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(naphthalen-1-ylcarbamothioyl)-4-phenylmethoxybenzamide |
| SMILES | O=C(NC(=S)Nc1cccc2ccccc12)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O2S/c28-24(20-13-15-21(16-14-20)29-17-18-7-2-1-3-8-18)27-25(30)26-23-12-6-10-19-9-4-5-11-22(19)23/h1-16H,17H2,(H2,26,27,28,30) |
| InChIKey | TWYFYZKRJRSTAF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|