C24H19N3O2S — CID 3896580
4-phenylmethoxy-N-(quinolin-8-ylcarbamothioyl)benzamide (PubChem CID 3896580) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-phenylmethoxy-N-(quinolin-8-ylcarbamothioyl)benzamide.
| Compound Name | 4-phenylmethoxy-N-(quinolin-8-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 3896580 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-phenylmethoxy-N-(quinolin-8-ylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)Nc1cccc2cccnc12)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c28-23(19-11-13-20(14-12-19)29-16-17-6-2-1-3-7-17)27-24(30)26-21-10-4-8-18-9-5-15-25-22(18)21/h1-15H,16H2,(H2,26,27,28,30) |
| InChIKey | SQWDCDXLBFGOHO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|