C21H26ClN3O4S — CID 4084114
1-(3-chloro-2-methylphenyl)-3-[(3,4,5-triethoxybenzoyl)amino]thiourea (PubChem CID 4084114) has the molecular formula C21H26ClN3O4S and a molecular weight of 451.98 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(3,4,5-triethoxybenzoyl)amino]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(3,4,5-triethoxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 4084114 |
| Molecular Formula | C21H26ClN3O4S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(3,4,5-triethoxybenzoyl)amino]thiourea |
| SMILES | CCOc1cc(C(=O)NNC(=S)Nc2cccc(Cl)c2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H26ClN3O4S/c1-5-27-17-11-14(12-18(28-6-2)19(17)29-7-3)20(26)24-25-21(30)23-16-10-8-9-15(22)13(16)4/h8-12H,5-7H2,1-4H3,(H,24,26)(H2,23,25,30) |
| InChIKey | YRXZMWJHCOHSEM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|