C17H17ClN2OS — CID 918712
N-[(3-chloro-2-methylphenyl)carbamothioyl]-3,5-dimethylbenzamide (PubChem CID 918712) has the molecular formula C17H17ClN2OS and a molecular weight of 332.86 g/mol. Its IUPAC name is N-[(3-chloro-2-methylphenyl)carbamothioyl]-3,5-dimethylbenzamide.
| Compound Name | N-[(3-chloro-2-methylphenyl)carbamothioyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 918712 |
| Molecular Formula | C17H17ClN2OS |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-[(3-chloro-2-methylphenyl)carbamothioyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)Nc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C17H17ClN2OS/c1-10-7-11(2)9-13(8-10)16(21)20-17(22)19-15-6-4-5-14(18)12(15)3/h4-9H,1-3H3,(H2,19,20,21,22) |
| InChIKey | IBNUTGPMUUDYBY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|