C13H8Cl3N3OS — CID 2774104
2,6-dichloro-N-[(2-chlorophenyl)carbamothioyl]pyridine-4-carboxamide (PubChem CID 2774104) has the molecular formula C13H8Cl3N3OS and a molecular weight of 360.65 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2-chlorophenyl)carbamothioyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[(2-chlorophenyl)carbamothioyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2774104 |
| Molecular Formula | C13H8Cl3N3OS |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2,6-dichloro-N-[(2-chlorophenyl)carbamothioyl]pyridine-4-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1Cl)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H8Cl3N3OS/c14-8-3-1-2-4-9(8)17-13(21)19-12(20)7-5-10(15)18-11(16)6-7/h1-6H,(H2,17,19,20,21) |
| InChIKey | JHZYJBLIQKIJPQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|