C12H15ClN2OS — CID 732169
N-[(2-chlorophenyl)carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 732169) has the molecular formula C12H15ClN2OS and a molecular weight of 270.78 g/mol. Its IUPAC name is N-[(2-chlorophenyl)carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2-chlorophenyl)carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 732169 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N-[(2-chlorophenyl)carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2OS/c1-12(2,3)10(16)15-11(17)14-9-7-5-4-6-8(9)13/h4-7H,1-3H3,(H2,14,15,16,17) |
| InChIKey | ODZQUQXLZURZDR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|