C13H14Cl3NO2 — CID 3277317
2,2-dichloro-N-(2-chlorophenyl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 3277317) has the molecular formula C13H14Cl3NO2 and a molecular weight of 322.62 g/mol. Its IUPAC name is 2,2-dichloro-N-(2-chlorophenyl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2,2-dichloro-N-(2-chlorophenyl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 3277317 |
| Molecular Formula | C13H14Cl3NO2 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2,2-dichloro-N-(2-chlorophenyl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CC(C)(C)C(=O)C(Cl)(Cl)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H14Cl3NO2/c1-12(2,3)10(18)13(15,16)11(19)17-9-7-5-4-6-8(9)14/h4-7H,1-3H3,(H,17,19) |
| InChIKey | KNBWGCALHBENLZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|