C15H21ClN2O2 — CID 108965988
N-tert-butyl-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108965988) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is N-tert-butyl-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-tert-butyl-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965988 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-tert-butyl-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C)NC(=O)C(C)(C)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H21ClN2O2/c1-14(2,3)18-13(20)15(4,5)12(19)17-11-9-7-6-8-10(11)16/h6-9H,1-5H3,(H,17,19)(H,18,20) |
| InChIKey | QIVLXRAKEGEBNA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|