C17H16BrClN2O2 — CID 108968886
N-(2-bromophenyl)-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108968886) has the molecular formula C17H16BrClN2O2 and a molecular weight of 395.68 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(2-bromophenyl)-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968886 |
| Molecular Formula | C17H16BrClN2O2 |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | N-(2-bromophenyl)-N'-(2-chlorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccccc1Cl)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C17H16BrClN2O2/c1-17(2,15(22)20-13-9-5-3-7-11(13)18)16(23)21-14-10-6-4-8-12(14)19/h3-10H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | KRGCZNJAJSCEIK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|