C10H8ClF2NO2 — CID 102107601
N-(2-chlorophenyl)-2,2-difluoro-3-oxobutanamide (PubChem CID 102107601) has the molecular formula C10H8ClF2NO2 and a molecular weight of 247.63 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,2-difluoro-3-oxobutanamide.
| Compound Name | N-(2-chlorophenyl)-2,2-difluoro-3-oxobutanamide |
|---|---|
| PubChem CID | 102107601 |
| Molecular Formula | C10H8ClF2NO2 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-(2-chlorophenyl)-2,2-difluoro-3-oxobutanamide |
| SMILES | CC(=O)C(F)(F)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C10H8ClF2NO2/c1-6(15)10(12,13)9(16)14-8-5-3-2-4-7(8)11/h2-5H,1H3,(H,14,16) |
| InChIKey | JJLQTBJLRCAZTI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|