C19H22ClN3O2 — CID 137086340
N-[N'-(2-chlorophenyl)-N-(2-methoxyphenyl)carbamimidoyl]-2,2-dimethylpropanamide (PubChem CID 137086340) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is N-[N'-(2-chlorophenyl)-N-(2-methoxyphenyl)carbamimidoyl]-2,2-dimethylpropanamide.
| Compound Name | N-[N'-(2-chlorophenyl)-N-(2-methoxyphenyl)carbamimidoyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137086340 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[N'-(2-chlorophenyl)-N-(2-methoxyphenyl)carbamimidoyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccccc1N/C(=N/c1ccccc1Cl)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H22ClN3O2/c1-19(2,3)17(24)23-18(21-14-10-6-5-9-13(14)20)22-15-11-7-8-12-16(15)25-4/h5-12H,1-4H3,(H2,21,22,23,24) |
| InChIKey | NNGIRNKVRCJCDL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|