About ethane;(2-methoxyphenyl)urea
ethane;(2-methoxyphenyl)urea (PubChem CID 143063924) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is ethane;(2-methoxyphenyl)urea.
Molecular Properties
| Compound Name | ethane;(2-methoxyphenyl)urea |
| PubChem CID | 143063924 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | ethane;(2-methoxyphenyl)urea |
| SMILES | CC.COc1ccccc1NC(N)=O |
| InChI | InChI=1S/C8H10N2O2.C2H6/c1-12-7-5-3-2-4-6(7)10-8(9)11;1-2/h2-5H,1H3,(H3,9,10,11);1-2H3 |
| InChIKey | CBPNNSYUGOUCAE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(2-methoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methoxyphenyl)urea?
The IUPAC name of ethane;(2-methoxyphenyl)urea (CID 143063924) is ethane;(2-methoxyphenyl)urea.
What is the SMILES notation for ethane;(2-methoxyphenyl)urea?
The canonical SMILES for ethane;(2-methoxyphenyl)urea is CC.COc1ccccc1NC(N)=O.
What is the InChIKey of ethane;(2-methoxyphenyl)urea?
The InChIKey is CBPNNSYUGOUCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.C2H6/c1-12-7-5-3-2-4-6(7)10-8(9)11;1-2/h2-5H,1H3,(H3,9,10,11);1-2H3.
What are the key properties of ethane;(2-methoxyphenyl)urea?
ethane;(2-methoxyphenyl)urea has a molecular weight of 196.25 g/mol, XLogP of 2.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methoxyphenyl)urea is sourced from PubChem (CID 143063924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).