C10H14N2O2 — CID 4216204
3-(2-methoxyphenyl)-1,1-dimethylurea (PubChem CID 4216204) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1,1-dimethylurea.
| Compound Name | 3-(2-methoxyphenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 4216204 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(2-methoxyphenyl)-1,1-dimethylurea |
| SMILES | COc1ccccc1NC(=O)N(C)C |
| InChI | InChI=1S/C10H14N2O2/c1-12(2)10(13)11-8-6-4-5-7-9(8)14-3/h4-7H,1-3H3,(H,11,13) |
| InChIKey | VGBBRJWFGAEXFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |