C13H17Cl3N4O2S — CID 7036833
1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]urea (PubChem CID 7036833) has the molecular formula C13H17Cl3N4O2S and a molecular weight of 399.73 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]urea |
|---|---|
| PubChem CID | 7036833 |
| Molecular Formula | C13H17Cl3N4O2S |
| Molecular Weight | 399.73 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 1,1-dimethyl-3-[(1R)-2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]urea |
| SMILES | COc1ccccc1NC(=S)NC(NC(=O)N(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H17Cl3N4O2S/c1-20(2)12(21)19-10(13(14,15)16)18-11(23)17-8-6-4-5-7-9(8)22-3/h4-7,10H,1-3H3,(H,19,21)(H2,17,18,23) |
| InChIKey | GGMNNTRYORIZAR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|