C20H22Cl3N3O3S — CID 2831480
2-(3,4-dimethoxyphenyl)-N-[2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 2831480) has the molecular formula C20H22Cl3N3O3S and a molecular weight of 490.84 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 2831480 |
| Molecular Formula | C20H22Cl3N3O3S |
| Molecular Weight | 490.84 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2,2,2-trichloro-1-[(2-methylphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)NC(NC(=S)Nc2ccccc2C)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C20H22Cl3N3O3S/c1-12-6-4-5-7-14(12)24-19(30)26-18(20(21,22)23)25-17(27)11-13-8-9-15(28-2)16(10-13)29-3/h4-10,18H,11H2,1-3H3,(H,25,27)(H2,24,26,30) |
| InChIKey | SXJUNHQOMZNRNQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|