C19H20Cl3N3O3S — CID 1354114
2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 1354114) has the molecular formula C19H20Cl3N3O3S and a molecular weight of 476.81 g/mol. Its IUPAC name is 2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 1354114 |
| Molecular Formula | C19H20Cl3N3O3S |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=S)NC(NC(=O)Cc2ccccc2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C19H20Cl3N3O3S/c1-27-13-8-9-15(28-2)14(11-13)23-18(29)25-17(19(20,21)22)24-16(26)10-12-6-4-3-5-7-12/h3-9,11,17H,10H2,1-2H3,(H,24,26)(H2,23,25,29) |
| InChIKey | ZCMFHJILOIWTQF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|