C19H18Cl5N3O3S — CID 1048523
2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 1048523) has the molecular formula C19H18Cl5N3O3S and a molecular weight of 545.70 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 1048523 |
| Molecular Formula | C19H18Cl5N3O3S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 542.95 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)N[C@H](NC(=S)Nc2c(Cl)cccc2Cl)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C19H18Cl5N3O3S/c1-29-13-7-6-10(8-14(13)30-2)9-15(28)25-17(19(22,23)24)27-18(31)26-16-11(20)4-3-5-12(16)21/h3-8,17H,9H2,1-2H3,(H,25,28)(H2,26,27,31)/t17-/m1/s1 |
| InChIKey | OETFYMJRFJHEGJ-QGZVFWFLSA-N |
| XLogP | 5.35 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|