C11H10Cl5N3O2S — CID 2301609
methyl N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 2301609) has the molecular formula C11H10Cl5N3O2S and a molecular weight of 425.55 g/mol. Its IUPAC name is methyl N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | methyl N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 2301609 |
| Molecular Formula | C11H10Cl5N3O2S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 422.89 |
| IUPAC Name | methyl N-[(1R)-2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | COC(=O)N[C@H](NC(=S)Nc1c(Cl)cccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl5N3O2S/c1-21-10(20)19-8(11(14,15)16)18-9(22)17-7-5(12)3-2-4-6(7)13/h2-4,8H,1H3,(H,19,20)(H2,17,18,22)/t8-/m0/s1 |
| InChIKey | DRWNHLIQGXLAGV-QMMMGPOBSA-N |
| XLogP | 4.33 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|