C17H15Cl4N3O2S — CID 1380239
4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 1380239) has the molecular formula C17H15Cl4N3O2S and a molecular weight of 467.21 g/mol. Its IUPAC name is 4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 1380239 |
| Molecular Formula | C17H15Cl4N3O2S |
| Molecular Weight | 467.21 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | 4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](NC(=S)Nc2ccccc2Cl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H15Cl4N3O2S/c1-26-11-8-6-10(7-9-11)14(25)23-15(17(19,20)21)24-16(27)22-13-5-3-2-4-12(13)18/h2-9,15H,1H3,(H,23,25)(H2,22,24,27)/t15-/m1/s1 |
| InChIKey | XUQNQYZSVBMIAB-OAHLLOKOSA-N |
| XLogP | 4.76 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.21 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|