C23H20Cl3N5O2S — CID 98116914
4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 98116914) has the molecular formula C23H20Cl3N5O2S and a molecular weight of 536.87 g/mol. Its IUPAC name is 4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 98116914 |
| Molecular Formula | C23H20Cl3N5O2S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 4-methoxy-N-[(1R)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](NC(=S)Nc2ccc(/N=N/c3ccccc3)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H20Cl3N5O2S/c1-33-19-13-7-15(8-14-19)20(32)28-21(23(24,25)26)29-22(34)27-16-9-11-18(12-10-16)31-30-17-5-3-2-4-6-17/h2-14,21H,1H3,(H,28,32)(H2,27,29,34)/b31-30+/t21-/m1/s1 |
| InChIKey | CUXQMUXMNKAQPA-LCYJPPDJSA-N |
| XLogP | 6.52 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|