C23H28Cl3N3O3S — CID 5253789
4-methoxy-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 5253789) has the molecular formula C23H28Cl3N3O3S and a molecular weight of 532.92 g/mol. Its IUPAC name is 4-methoxy-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 5253789 |
| Molecular Formula | C23H28Cl3N3O3S |
| Molecular Weight | 532.92 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 4-methoxy-N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | CCCCCCOc1ccc(NC(=S)NC(NC(=O)c2ccc(OC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H28Cl3N3O3S/c1-3-4-5-6-15-32-19-13-9-17(10-14-19)27-22(33)29-21(23(24,25)26)28-20(30)16-7-11-18(31-2)12-8-16/h7-14,21H,3-6,15H2,1-2H3,(H,28,30)(H2,27,29,33) |
| InChIKey | JTNIWGLIDRHSGY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|