C18H26Cl3N3O3S — CID 5258722
ethyl N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 5258722) has the molecular formula C18H26Cl3N3O3S and a molecular weight of 470.85 g/mol. Its IUPAC name is ethyl N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 5258722 |
| Molecular Formula | C18H26Cl3N3O3S |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | ethyl N-[2,2,2-trichloro-1-[(4-hexoxyphenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CCCCCCOc1ccc(NC(=S)NC(NC(=O)OCC)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H26Cl3N3O3S/c1-3-5-6-7-12-27-14-10-8-13(9-11-14)22-16(28)23-15(18(19,20)21)24-17(25)26-4-2/h8-11,15H,3-7,12H2,1-2H3,(H,24,25)(H2,22,23,28) |
| InChIKey | XRYSOEBACCDSQI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|