C17H24Cl3N3O2S — CID 40581858
methyl N-[(1R)-2,2,2-trichloro-1-[(4-hexylphenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 40581858) has the molecular formula C17H24Cl3N3O2S and a molecular weight of 440.82 g/mol. Its IUPAC name is methyl N-[(1R)-2,2,2-trichloro-1-[(4-hexylphenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | methyl N-[(1R)-2,2,2-trichloro-1-[(4-hexylphenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 40581858 |
| Molecular Formula | C17H24Cl3N3O2S |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | methyl N-[(1R)-2,2,2-trichloro-1-[(4-hexylphenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CCCCCCc1ccc(NC(=S)N[C@@H](NC(=O)OC)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H24Cl3N3O2S/c1-3-4-5-6-7-12-8-10-13(11-9-12)21-15(26)22-14(17(18,19)20)23-16(24)25-2/h8-11,14H,3-7H2,1-2H3,(H,23,24)(H2,21,22,26)/t14-/m0/s1 |
| InChIKey | FGELJTGCOGMKPW-AWEZNQCLSA-N |
| XLogP | 5.15 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|