C16H20Cl3N3O3S — CID 3093407
4-[[2,2,2-trichloro-1-(hexanoylamino)ethyl]carbamothioylamino]benzoic acid (PubChem CID 3093407) has the molecular formula C16H20Cl3N3O3S and a molecular weight of 440.78 g/mol. Its IUPAC name is 4-[[2,2,2-trichloro-1-(hexanoylamino)ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 4-[[2,2,2-trichloro-1-(hexanoylamino)ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3093407 |
| Molecular Formula | C16H20Cl3N3O3S |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 4-[[2,2,2-trichloro-1-(hexanoylamino)ethyl]carbamothioylamino]benzoic acid |
| SMILES | CCCCCC(=O)NC(NC(=S)Nc1ccc(C(=O)O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20Cl3N3O3S/c1-2-3-4-5-12(23)21-14(16(17,18)19)22-15(26)20-11-8-6-10(7-9-11)13(24)25/h6-9,14H,2-5H2,1H3,(H,21,23)(H,24,25)(H2,20,22,26) |
| InChIKey | KLNHXRXDHYCJIA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|