C20H28Cl3N3O3S — CID 3507549
3-[[2,2,2-trichloro-1-(decanoylamino)ethyl]carbamothioylamino]benzoic acid (PubChem CID 3507549) has the molecular formula C20H28Cl3N3O3S and a molecular weight of 496.89 g/mol. Its IUPAC name is 3-[[2,2,2-trichloro-1-(decanoylamino)ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 3-[[2,2,2-trichloro-1-(decanoylamino)ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3507549 |
| Molecular Formula | C20H28Cl3N3O3S |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 3-[[2,2,2-trichloro-1-(decanoylamino)ethyl]carbamothioylamino]benzoic acid |
| SMILES | CCCCCCCCCC(=O)NC(NC(=S)Nc1cccc(C(=O)O)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H28Cl3N3O3S/c1-2-3-4-5-6-7-8-12-16(27)25-18(20(21,22)23)26-19(30)24-15-11-9-10-14(13-15)17(28)29/h9-11,13,18H,2-8,12H2,1H3,(H,25,27)(H,28,29)(H2,24,26,30) |
| InChIKey | RPXOCPQSVKGZMV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|