C16H20Cl5N3OS — CID 92837357
N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]heptanamide (PubChem CID 92837357) has the molecular formula C16H20Cl5N3OS and a molecular weight of 479.69 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]heptanamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]heptanamide |
|---|---|
| PubChem CID | 92837357 |
| Molecular Formula | C16H20Cl5N3OS |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@H](NC(=S)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20Cl5N3OS/c1-2-3-4-5-6-13(25)23-14(16(19,20)21)24-15(26)22-10-7-8-11(17)12(18)9-10/h7-9,14H,2-6H2,1H3,(H,23,25)(H2,22,24,26)/t14-/m1/s1 |
| InChIKey | GCMNLYLEOFZYTA-CQSZACIVSA-N |
| XLogP | 6.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|