C12H12Cl5N3OS — CID 2906050
N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]propanamide (PubChem CID 2906050) has the molecular formula C12H12Cl5N3OS and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]propanamide.
| Compound Name | N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 2906050 |
| Molecular Formula | C12H12Cl5N3OS |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]propanamide |
| SMILES | CCC(=O)NC(NC(=S)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl5N3OS/c1-2-9(21)19-10(12(15,16)17)20-11(22)18-6-3-4-7(13)8(14)5-6/h3-5,10H,2H2,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | JITBQBLDKOYQNS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|