C14H10Cl5N3O2S — CID 1119006
N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]furan-2-carboxamide (PubChem CID 1119006) has the molecular formula C14H10Cl5N3O2S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1119006 |
| Molecular Formula | C14H10Cl5N3O2S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 458.89 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(N[C@H](NC(=S)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C14H10Cl5N3O2S/c15-8-4-3-7(6-9(8)16)20-13(25)22-12(14(17,18)19)21-11(23)10-2-1-5-24-10/h1-6,12H,(H,21,23)(H2,20,22,25)/t12-/m1/s1 |
| InChIKey | QHNFAFHDKSFGKO-GFCCVEGCSA-N |
| XLogP | 5.00 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|