C14H11Cl3IN3O2S — CID 1380677
N-[(1S)-2,2,2-trichloro-1-[(2-iodophenyl)carbamothioylamino]ethyl]furan-2-carboxamide (PubChem CID 1380677) has the molecular formula C14H11Cl3IN3O2S and a molecular weight of 518.59 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(2-iodophenyl)carbamothioylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(2-iodophenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1380677 |
| Molecular Formula | C14H11Cl3IN3O2S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 516.87 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(2-iodophenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1ccccc1I)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C14H11Cl3IN3O2S/c15-14(16,17)12(20-11(22)10-6-3-7-23-10)21-13(24)19-9-5-2-1-4-8(9)18/h1-7,12H,(H,20,22)(H2,19,21,24)/t12-/m0/s1 |
| InChIKey | BHBMACJJPJUQEG-LBPRGKRZSA-N |
| XLogP | 4.30 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|