C11H9Cl3N4O2 — CID 723261
N-[(1R)-2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]furan-2-carboxamide (PubChem CID 723261) has the molecular formula C11H9Cl3N4O2 and a molecular weight of 335.58 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 723261 |
| Molecular Formula | C11H9Cl3N4O2 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H](Nc1ncccn1)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C11H9Cl3N4O2/c12-11(13,14)9(18-10-15-4-2-5-16-10)17-8(19)7-3-1-6-20-7/h1-6,9H,(H,17,19)(H,15,16,18)/t9-/m0/s1 |
| InChIKey | BNYINSCAZVSNAK-VIFPVBQESA-N |
| XLogP | 2.61 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|