C11H15Cl3N2O3 — CID 31725764
N-[(1S)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]furan-2-carboxamide (PubChem CID 31725764) has the molecular formula C11H15Cl3N2O3 and a molecular weight of 329.61 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31725764 |
| Molecular Formula | C11H15Cl3N2O3 |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]furan-2-carboxamide |
| SMILES | COCCCN[C@@H](NC(=O)c1ccco1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H15Cl3N2O3/c1-18-6-3-5-15-10(11(12,13)14)16-9(17)8-4-2-7-19-8/h2,4,7,10,15H,3,5-6H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | FEBHSNQKQGTCBC-JTQLQIEISA-N |
| XLogP | 2.33 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|