C13H16Cl4N2O2 — CID 3103413
4-chloro-N-[2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide (PubChem CID 3103413) has the molecular formula C13H16Cl4N2O2 and a molecular weight of 374.10 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3103413 |
| Molecular Formula | C13H16Cl4N2O2 |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide |
| SMILES | COCCCNC(NC(=O)c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl4N2O2/c1-21-8-2-7-18-12(13(15,16)17)19-11(20)9-3-5-10(14)6-4-9/h3-6,12,18H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | BDGBJEYKWKEPGC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|