C14H19Cl3N2O3 — CID 7024523
4-methoxy-N-[(1R)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide (PubChem CID 7024523) has the molecular formula C14H19Cl3N2O3 and a molecular weight of 369.68 g/mol. Its IUPAC name is 4-methoxy-N-[(1R)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1R)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 7024523 |
| Molecular Formula | C14H19Cl3N2O3 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4-methoxy-N-[(1R)-2,2,2-trichloro-1-(3-methoxypropylamino)ethyl]benzamide |
| SMILES | COCCCN[C@H](NC(=O)c1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N2O3/c1-21-9-3-8-18-13(14(15,16)17)19-12(20)10-4-6-11(22-2)7-5-10/h4-7,13,18H,3,8-9H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | PHZNVZQXTLLUPY-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|