C10H9Cl4NO2 — CID 51602914
4-methoxy-N-[(1S)-1,2,2,2-tetrachloroethyl]benzamide (PubChem CID 51602914) has the molecular formula C10H9Cl4NO2 and a molecular weight of 317.00 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-1,2,2,2-tetrachloroethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1S)-1,2,2,2-tetrachloroethyl]benzamide |
|---|---|
| PubChem CID | 51602914 |
| Molecular Formula | C10H9Cl4NO2 |
| Molecular Weight | 317.00 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | 4-methoxy-N-[(1S)-1,2,2,2-tetrachloroethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](Cl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H9Cl4NO2/c1-17-7-4-2-6(3-5-7)8(16)15-9(11)10(12,13)14/h2-5,9H,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | WPQYXDICFPONOB-SECBINFHSA-N |
| XLogP | 3.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|