C14H20Cl3N2O2+ — CID 7032634
butyl-[(1S)-2,2,2-trichloro-1-[(4-methoxybenzoyl)amino]ethyl]azanium (PubChem CID 7032634) has the molecular formula C14H20Cl3N2O2+ and a molecular weight of 354.69 g/mol. Its IUPAC name is butyl-[(1S)-2,2,2-trichloro-1-[(4-methoxybenzoyl)amino]ethyl]azanium.
| Compound Name | butyl-[(1S)-2,2,2-trichloro-1-[(4-methoxybenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7032634 |
| Molecular Formula | C14H20Cl3N2O2+ |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | butyl-[(1S)-2,2,2-trichloro-1-[(4-methoxybenzoyl)amino]ethyl]azanium |
| SMILES | CCCC[NH2+][C@H](NC(=O)c1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N2O2/c1-3-4-9-18-13(14(15,16)17)19-12(20)10-5-7-11(21-2)8-6-10/h5-8,13,18H,3-4,9H2,1-2H3,(H,19,20)/p+1/t13-/m1/s1 |
| InChIKey | FMHLTENBZQGYLU-CYBMUJFWSA-O |
| XLogP | 2.48 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|