C19H20Cl3NO3 — CID 4274925
4-(4-butoxyphenyl)-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide (PubChem CID 4274925) has the molecular formula C19H20Cl3NO3 and a molecular weight of 416.73 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide.
| Compound Name | 4-(4-butoxyphenyl)-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 4274925 |
| Molecular Formula | C19H20Cl3NO3 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 4-(4-butoxyphenyl)-N-(2,2,2-trichloro-1-hydroxyethyl)benzamide |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)NC(O)C(Cl)(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20Cl3NO3/c1-2-3-12-26-16-10-8-14(9-11-16)13-4-6-15(7-5-13)17(24)23-18(25)19(20,21)22/h4-11,18,25H,2-3,12H2,1H3,(H,23,24) |
| InChIKey | OAEPOKPVBSEENH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|