C17H25NO5 — CID 95635789
ethyl (2R,3R)-2-[(4-butoxybenzoyl)amino]-3-hydroxybutanoate (PubChem CID 95635789) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl (2R,3R)-2-[(4-butoxybenzoyl)amino]-3-hydroxybutanoate.
| Compound Name | ethyl (2R,3R)-2-[(4-butoxybenzoyl)amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 95635789 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethyl (2R,3R)-2-[(4-butoxybenzoyl)amino]-3-hydroxybutanoate |
| SMILES | CCCCOc1ccc(C(=O)N[C@@H](C(=O)OCC)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C17H25NO5/c1-4-6-11-23-14-9-7-13(8-10-14)16(20)18-15(12(3)19)17(21)22-5-2/h7-10,12,15,19H,4-6,11H2,1-3H3,(H,18,20)/t12-,15-/m1/s1 |
| InChIKey | LGJBCDLRCVPJTK-IUODEOHRSA-N |
| XLogP | 1.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|